Products 1797295-05-6
CAS 1797295-05-6 is the registry number for tert-butyl N-[4-(5-sulfanyl-1,3,4-oxadiazol-2-yl)phenyl]carbamate. Offered by: Chemat. Available pack sizes: 250mg.
Tert-butyl N-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]carbamate (CAS 1797295-05-6) is a chemical compound with the molecular formula C13H15N3O3S and a molecular weight of 293.34 g/mol. IUPAC name: tert-butyl N-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]carbamate. InChIKey: DYHOFKDCXWEPEC-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O3S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | tert-butyl N-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]carbamate |
| InChIKey | DYHOFKDCXWEPEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)