CAS 380344-09-2 is the registry number for 3,4-Diamino-N-(4-methoxyphenyl)benzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3,4-diamino-N-(4-methoxyphenyl)benzenesulfonamide (CAS 380344-09-2) is a chemical compound with the molecular formula C13H15N3O3S and a molecular weight of 293.34 g/mol. IUPAC name: 3,4-diamino-N-(4-methoxyphenyl)benzenesulfonamide. InChIKey: VLJRZEZDHGBSPU-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O3S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 3,4-diamino-N-(4-methoxyphenyl)benzenesulfonamide |
| InChIKey | VLJRZEZDHGBSPU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)