CAS 1340932-31-1 is the registry number for 2-(Pyridin-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridin-8-amine (CAS 1340932-31-1) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridin-8-amine. InChIKey: ZLEOMDSWOCBTBF-UHFFFAOYSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-pyridin-3-yl-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| InChIKey | ZLEOMDSWOCBTBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN3C=CC=C(C3=N2)N |
Computed by PubChem (NCBI)