CAS 1343841-52-0 is the registry number for 3-(Quinolin-6-yl)-1H-1,2,4-triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-quinolin-6-yl-1H-1,2,4-triazol-3-amine (CAS 1343841-52-0) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: 5-quinolin-6-yl-1H-1,2,4-triazol-3-amine. InChIKey: XOFCYCTWZIWCSJ-UHFFFAOYSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-quinolin-6-yl-1H-1,2,4-triazol-3-amine |
| InChIKey | XOFCYCTWZIWCSJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=NC(=NN3)N)N=C1 |
Computed by PubChem (NCBI)