CAS 338793-57-0 is the registry number for 3-[2-(1H-Imidazol-1-yl)phenyl]-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2-imidazol-1-ylphenyl)-1H-1,2,4-triazole (CAS 338793-57-0) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: 5-(2-imidazol-1-ylphenyl)-1H-1,2,4-triazole. InChIKey: MEOQWPMLKZKWFI-UHFFFAOYSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-(2-imidazol-1-ylphenyl)-1H-1,2,4-triazole |
| InChIKey | MEOQWPMLKZKWFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=NN2)N3C=CN=C3 |
Computed by PubChem (NCBI)