CAS 1548566-83-1 is the registry number for 2-Bromo-n-cyclobutyl-5-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-cyclobutyl-5-methylaniline (CAS 1548566-83-1) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 2-bromo-N-cyclobutyl-5-methylaniline. InChIKey: YJCBLHUXHGCTPA-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 2-bromo-N-cyclobutyl-5-methylaniline |
| InChIKey | YJCBLHUXHGCTPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Br)NC2CCC2 |
Computed by PubChem (NCBI)