CAS 1341039-29-9 appears in our catalog under these names: 1-(4-Chloromethyl-phenyl)-1h-[1,2,3]triazole, 95%, 1–(4–(Chloromethyl)phenyl)–1H–1,2,3–triazole, 1-(4-(Chloromethyl)phenyl)-1H-1,2,3-triazole. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg.
1-[4-(chloromethyl)phenyl]triazole (CAS 1341039-29-9) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 1-[4-(chloromethyl)phenyl]triazole. InChIKey: KFNQAYDGVQSDFT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 1-[4-(chloromethyl)phenyl]triazole |
| InChIKey | KFNQAYDGVQSDFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)N2C=CN=N2 |
Computed by PubChem (NCBI)