Products 1341063-42-0
CAS 1341063-42-0 is the registry number for 3-Amino-1-(2,4-difluorophenyl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-amino-1-(2,4-difluorophenyl)piperidin-2-one (CAS 1341063-42-0) is a chemical compound with the molecular formula C11H12F2N2O and a molecular weight of 226.22 g/mol. IUPAC name: 3-amino-1-(2,4-difluorophenyl)piperidin-2-one. InChIKey: ICHBVVBYLROTKC-UHFFFAOYSA-N.
| Molecular formula | C11H12F2N2O |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 3-amino-1-(2,4-difluorophenyl)piperidin-2-one |
| InChIKey | ICHBVVBYLROTKC-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=C(C=C(C=C2)F)F)N |
Computed by PubChem (NCBI)