Products 1341215-25-5
CAS 1341215-25-5 appears in our catalog under these names: 2，2–difluoro–2–(3–fluorophenyl)ethan–1–ol, 2,2-Difluoro-2-(3-fluorophenyl)ethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2,2-difluoro-2-(3-fluorophenyl)ethanol (CAS 1341215-25-5) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: 2,2-difluoro-2-(3-fluorophenyl)ethanol. InChIKey: VQSBILACWIQXGT-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2,2-difluoro-2-(3-fluorophenyl)ethanol |
| InChIKey | VQSBILACWIQXGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(CO)(F)F |
Computed by PubChem (NCBI)