Products 1341381-15-4

CAS 1341381-15-4 is the registry number for 2-((2-Methyl-3-(methylthio)propyl)amino)-2-oxoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetic acid (CAS 1341381-15-4) is a chemical compound with the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. IUPAC name: 2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetic acid. InChIKey: ITXDNOIVLNKUBI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO3S
Molecular weight191.25 g/mol
IUPAC name2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetic acid
InChIKeyITXDNOIVLNKUBI-UHFFFAOYSA-N
SMILESCC(CNC(=O)C(=O)O)CSC

Computed by PubChem (NCBI)