Products 1341530-92-4
CAS 1341530-92-4 appears in our catalog under these names: 3-Bromo-1-(2-chlorophenyl)piperidin-2-one, 95%, 3-Bromo-1-(2-chlorophenyl)piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-bromo-1-(2-chlorophenyl)piperidin-2-one (CAS 1341530-92-4) is a chemical compound with the molecular formula C11H11BrClNO and a molecular weight of 288.57 g/mol. IUPAC name: 3-bromo-1-(2-chlorophenyl)piperidin-2-one. InChIKey: NLVSBBUEHDVHOP-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClNO |
|---|---|
| Molecular weight | 288.57 g/mol |
| IUPAC name | 3-bromo-1-(2-chlorophenyl)piperidin-2-one |
| InChIKey | NLVSBBUEHDVHOP-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC=CC=C2Cl)Br |
Computed by PubChem (NCBI)