CAS 1404431-54-4 is the registry number for 1-(5-Bromo-3,4-dihydroquinolin-1(2h)-yl)-2-chloroethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone (CAS 1404431-54-4) is a chemical compound with the molecular formula C11H11BrClNO and a molecular weight of 288.57 g/mol. IUPAC name: 1-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone. InChIKey: OMCVLRPTBAKUAE-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClNO |
|---|---|
| Molecular weight | 288.57 g/mol |
| IUPAC name | 1-(5-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-chloroethanone |
| InChIKey | OMCVLRPTBAKUAE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=C2Br)N(C1)C(=O)CCl |
Computed by PubChem (NCBI)