Products 849106-18-9
CAS 849106-18-9 is the registry number for 2-(2-Bromo-5-chlorophenyl)-4,4-dimethyl-4,5-dihydrooxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(2-bromo-5-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 849106-18-9) is a chemical compound with the molecular formula C11H11BrClNO and a molecular weight of 288.57 g/mol. IUPAC name: 2-(2-bromo-5-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: WZZBFPGFGCRSCK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClNO |
|---|---|
| Molecular weight | 288.57 g/mol |
| IUPAC name | 2-(2-bromo-5-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | WZZBFPGFGCRSCK-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=C(C=CC(=C2)Cl)Br)C |
Computed by PubChem (NCBI)