CAS 1341900-28-4 appears in our catalog under these names: 2-(4-Bromo-1H-pyrazol-1-yl)-3-fluoropyridine, 95%, 2-(4-Bromo-1H-pyrazol-1-yl)-3-fluoropyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(4-bromopyrazol-1-yl)-3-fluoropyridine (CAS 1341900-28-4) is a chemical compound with the molecular formula C8H5BrFN3 and a molecular weight of 242.05 g/mol. IUPAC name: 2-(4-bromopyrazol-1-yl)-3-fluoropyridine. InChIKey: HURNEWQPLMWVDA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFN3 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 2-(4-bromopyrazol-1-yl)-3-fluoropyridine |
| InChIKey | HURNEWQPLMWVDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=C(C=N2)Br)F |
Computed by PubChem (NCBI)