CAS 1379357-13-7 appears in our catalog under these names: 6-Bromo-8-fluoroquinazolin-4-amine, 97%, 6-Bromo-8-fluoroquinazolin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
6-bromo-8-fluoroquinazolin-4-amine (CAS 1379357-13-7) is a chemical compound with the molecular formula C8H5BrFN3 and a molecular weight of 242.05 g/mol. IUPAC name: 6-bromo-8-fluoroquinazolin-4-amine. InChIKey: UNVPWZRBRPYSDL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFN3 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 6-bromo-8-fluoroquinazolin-4-amine |
| InChIKey | UNVPWZRBRPYSDL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC=N2)N)F)Br |
Computed by PubChem (NCBI)