CAS 623577-63-9 appears in our catalog under these names: 3-Bromo-1-(4-fluorophenyl)-1H-1,2,4-triazole, 95%, 3-Bromo-1-(4-fluorophenyl)-1H-1,2,4-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-bromo-1-(4-fluorophenyl)-1,2,4-triazole (CAS 623577-63-9) is a chemical compound with the molecular formula C8H5BrFN3 and a molecular weight of 242.05 g/mol. IUPAC name: 3-bromo-1-(4-fluorophenyl)-1,2,4-triazole. InChIKey: BXDJOYGNKVVADL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFN3 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 3-bromo-1-(4-fluorophenyl)-1,2,4-triazole |
| InChIKey | BXDJOYGNKVVADL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC(=N2)Br)F |
Computed by PubChem (NCBI)