CAS 13420-86-5 is the registry number for 1-Chlorodibenzo[b,f]thiepin-10(11H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5H-benzo[b][1]benzothiepin-6-one (CAS 13420-86-5) is a chemical compound with the molecular formula C14H9ClOS and a molecular weight of 260.7 g/mol. IUPAC name: 4-chloro-5H-benzo[b][1]benzothiepin-6-one. InChIKey: PRBUKANOZQKNQC-UHFFFAOYSA-N.
| Molecular formula | C14H9ClOS |
|---|---|
| Molecular weight | 260.7 g/mol |
| IUPAC name | 4-chloro-5H-benzo[b][1]benzothiepin-6-one |
| InChIKey | PRBUKANOZQKNQC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Cl)SC3=CC=CC=C3C1=O |
Computed by PubChem (NCBI)