CAS 1469-28-9 appears in our catalog under these names: 8-Chlorodibenzo(b,f)thiepin-10(11H)-one, >95% (HPLC), 6-Chloro-2-thiatricyclo(9.4.0.0,3,8)pentadeca-1(15),3,5,7,11,13-hexaen-9-one, 8-Chlorodibenzo[b,f]thiepin-10(11H)-one, 95+%, 95+%, 6-Chloro-2-thiatricyclo[9.4.0.0,3,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-one, 95+%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 25mg, 0,25g, 5g, 100g, 25g.
3-chloro-6H-benzo[b][1]benzothiepin-5-one (CAS 1469-28-9) is a chemical compound with the molecular formula C14H9ClOS and a molecular weight of 260.7 g/mol. IUPAC name: 3-chloro-6H-benzo[b][1]benzothiepin-5-one. InChIKey: RFEQOXYRLRIDPF-UHFFFAOYSA-N.
| Molecular formula | C14H9ClOS |
|---|---|
| Molecular weight | 260.7 g/mol |
| IUPAC name | 3-chloro-6H-benzo[b][1]benzothiepin-5-one |
| InChIKey | RFEQOXYRLRIDPF-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2SC3=C(C1=O)C=C(C=C3)Cl |
Computed by PubChem (NCBI)