CAS 2276636-11-2 is the registry number for 10-Chlorodibenzo[b,e]thiepin-11(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
10-chloro-6H-benzo[c][1]benzothiepin-11-one (CAS 2276636-11-2) is a chemical compound with the molecular formula C14H9ClOS and a molecular weight of 260.7 g/mol. IUPAC name: 10-chloro-6H-benzo[c][1]benzothiepin-11-one. InChIKey: NEYLWWAESIFOSF-UHFFFAOYSA-N.
| Molecular formula | C14H9ClOS |
|---|---|
| Molecular weight | 260.7 g/mol |
| IUPAC name | 10-chloro-6H-benzo[c][1]benzothiepin-11-one |
| InChIKey | NEYLWWAESIFOSF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)Cl)C(=O)C3=CC=CC=C3S1 |
Computed by PubChem (NCBI)