Products 1342107-08-7
CAS 1342107-08-7 is the registry number for N-(3-Bromothiophene-2-carbonyl)-N-cyclopropylglycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-bromothiophene-2-carbonyl)-cyclopropylamino]acetic acid (CAS 1342107-08-7) is a chemical compound with the molecular formula C10H10BrNO3S and a molecular weight of 304.16 g/mol. IUPAC name: 2-[(3-bromothiophene-2-carbonyl)-cyclopropylamino]acetic acid. InChIKey: GAGSYXVWZKWBSR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3S |
|---|---|
| Molecular weight | 304.16 g/mol |
| IUPAC name | 2-[(3-bromothiophene-2-carbonyl)-cyclopropylamino]acetic acid |
| InChIKey | GAGSYXVWZKWBSR-UHFFFAOYSA-N |
| SMILES | C1CC1N(CC(=O)O)C(=O)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)