Products 914630-14-1
CAS 914630-14-1 appears in our catalog under these names: 2-(([(3-Bromophenyl)carbamoyl]methyl)sulfanyl)acetic acid, 95%, 2-({((3-Bromophenyl)carbamoyl)methyl}sulfanyl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[2-(3-bromoanilino)-2-oxoethyl]sulfanylacetic acid (CAS 914630-14-1) is a chemical compound with the molecular formula C10H10BrNO3S and a molecular weight of 304.16 g/mol. IUPAC name: 2-[2-(3-bromoanilino)-2-oxoethyl]sulfanylacetic acid. InChIKey: QTVXJTMTMLWPBV-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3S |
|---|---|
| Molecular weight | 304.16 g/mol |
| IUPAC name | 2-[2-(3-bromoanilino)-2-oxoethyl]sulfanylacetic acid |
| InChIKey | QTVXJTMTMLWPBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC(=O)CSCC(=O)O |
Computed by PubChem (NCBI)