CAS 2270909-80-1 is the registry number for Cyclopropanesulfonic acid 3-bromo-benzoylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N-cyclopropylsulfonylbenzamide (CAS 2270909-80-1) is a chemical compound with the molecular formula C10H10BrNO3S and a molecular weight of 304.16 g/mol. IUPAC name: 3-bromo-N-cyclopropylsulfonylbenzamide. InChIKey: AVCUNBLPPMXYCB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3S |
|---|---|
| Molecular weight | 304.16 g/mol |
| IUPAC name | 3-bromo-N-cyclopropylsulfonylbenzamide |
| InChIKey | AVCUNBLPPMXYCB-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)NC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)