Products 1342285-53-3
CAS 1342285-53-3 is the registry number for 2-(3-Bromo-4-fluorophenyl)-2-hydroxypropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoic acid (CAS 1342285-53-3) is a chemical compound with the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. IUPAC name: 2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoic acid. InChIKey: WNUUXMYYDGHWIJ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO3 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 2-(3-bromo-4-fluorophenyl)-2-hydroxypropanoic acid |
| InChIKey | WNUUXMYYDGHWIJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)F)Br)(C(=O)O)O |
Computed by PubChem (NCBI)