CAS 1342447-34-0 is the registry number for (2-(3,4-Dichlorophenyl)-1H-imidazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]methanol (CAS 1342447-34-0) is a chemical compound with the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. IUPAC name: [2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]methanol. InChIKey: WCEWQIVSGNWOOG-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [2-(3,4-dichlorophenyl)-1H-imidazol-5-yl]methanol |
| InChIKey | WCEWQIVSGNWOOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC=C(N2)CO)Cl)Cl |
Computed by PubChem (NCBI)