Products 1342653-06-8
CAS 1342653-06-8 is the registry number for 1-(3-Bromophenyl)-3-oxocyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-bromophenyl)-3-oxocyclobutane-1-carboxylic acid (CAS 1342653-06-8) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: 1-(3-bromophenyl)-3-oxocyclobutane-1-carboxylic acid. InChIKey: DLOZFXSVHTYQQM-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3-oxocyclobutane-1-carboxylic acid |
| InChIKey | DLOZFXSVHTYQQM-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC1(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)