CAS 1342653-11-5 is the registry number for 1-(2,5-dichlorophenyl)cyclohexanol, ≥99.8%, ≥99.8%. Offered by: Chemat. Available pack sizes: 1g.
1-(2,5-dichlorophenyl)cyclohexan-1-ol (CAS 1342653-11-5) is a chemical compound with the molecular formula C12H14Cl2O and a molecular weight of 245.14 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)cyclohexan-1-ol. InChIKey: DCURZTONRNSZFR-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)cyclohexan-1-ol |
| InChIKey | DCURZTONRNSZFR-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=C(C=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)