CAS 88374-07-6 is the registry number for 2-butyl-2-(2,4-dichlorophenyl)oxirane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-butyl-2-(2,4-dichlorophenyl)oxirane (CAS 88374-07-6) is a chemical compound with the molecular formula C12H14Cl2O and a molecular weight of 245.14 g/mol. IUPAC name: 2-butyl-2-(2,4-dichlorophenyl)oxirane. InChIKey: SBPUYQOPWLYDBB-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 2-butyl-2-(2,4-dichlorophenyl)oxirane |
| InChIKey | SBPUYQOPWLYDBB-UHFFFAOYSA-N |
| SMILES | CCCCC1(CO1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)