CAS 148990-19-6 is the registry number for 4-(Dichloromethyl)-2,3,5,6-tetramethylbenzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(dichloromethyl)-2,3,5,6-tetramethylbenzaldehyde (CAS 148990-19-6) is a chemical compound with the molecular formula C12H14Cl2O and a molecular weight of 245.14 g/mol. IUPAC name: 4-(dichloromethyl)-2,3,5,6-tetramethylbenzaldehyde. InChIKey: IBYGLWWBFPWRRH-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 4-(dichloromethyl)-2,3,5,6-tetramethylbenzaldehyde |
| InChIKey | IBYGLWWBFPWRRH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C=O)C)C)C(Cl)Cl)C |
Computed by PubChem (NCBI)