Products 1342690-59-8
CAS 1342690-59-8 appears in our catalog under these names: 1-Methanesulfonylpyrrolidine-3-carboxylic acid, 95%, 1-Methanesulfonylpyrrolidine-3-carboxylic acid, 98%, 1-Methanesulfonylpyrrolidine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 25g, 2,5g.
1-methylsulfonylpyrrolidine-3-carboxylic acid (CAS 1342690-59-8) is a chemical compound with the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. IUPAC name: 1-methylsulfonylpyrrolidine-3-carboxylic acid. InChIKey: MNRXMPRVFBDVJX-UHFFFAOYSA-N.
| Molecular formula | C6H11NO4S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 1-methylsulfonylpyrrolidine-3-carboxylic acid |
| InChIKey | MNRXMPRVFBDVJX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(C1)C(=O)O |
Computed by PubChem (NCBI)