CAS 1219828-33-7 appears in our catalog under these names: 1-(Ethanesulfonyl)azetidine-3-carboxylic acid, 96%, 1-(Ethanesulfonyl)azetidine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
1-ethylsulfonylazetidine-3-carboxylic acid (CAS 1219828-33-7) is a chemical compound with the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. IUPAC name: 1-ethylsulfonylazetidine-3-carboxylic acid. InChIKey: GSAXUQYIQDBQMC-UHFFFAOYSA-N.
| Molecular formula | C6H11NO4S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 1-ethylsulfonylazetidine-3-carboxylic acid |
| InChIKey | GSAXUQYIQDBQMC-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CC(C1)C(=O)O |
Computed by PubChem (NCBI)