Products 2165595-27-5
CAS 2165595-27-5 appears in our catalog under these names: (3R)-1-methanesulfonylpyrrolidine-3-carboxylic acid, 95%, 95%, (R)-1-(Methylsulfonyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3R)-1-methylsulfonylpyrrolidine-3-carboxylic acid (CAS 2165595-27-5) is a chemical compound with the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. IUPAC name: (3R)-1-methylsulfonylpyrrolidine-3-carboxylic acid. InChIKey: MNRXMPRVFBDVJX-RXMQYKEDSA-N.
| Molecular formula | C6H11NO4S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | (3R)-1-methylsulfonylpyrrolidine-3-carboxylic acid |
| InChIKey | MNRXMPRVFBDVJX-RXMQYKEDSA-N |
| SMILES | CS(=O)(=O)N1CC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)