Products 1342698-64-9

CAS 1342698-64-9 is the registry number for 9H-Fluoren-9-ylmethyl N-(2-hydroxycyclohexyl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

9H-fluoren-9-ylmethyl N-(2-hydroxycyclohexyl)carbamate (CAS 1342698-64-9) is a chemical compound with the molecular formula C21H23NO3 and a molecular weight of 337.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-hydroxycyclohexyl)carbamate. InChIKey: LLLFJVDKWZWPHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO3
Molecular weight337.4 g/mol
IUPAC name9H-fluoren-9-ylmethyl N-(2-hydroxycyclohexyl)carbamate
InChIKeyLLLFJVDKWZWPHJ-UHFFFAOYSA-N
SMILESC1CCC(C(C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O

Computed by PubChem (NCBI)