CAS 1342765-18-7 is the registry number for 1-(2-Phenylethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-phenylethyl)pyrazole-3-carboxylic acid (CAS 1342765-18-7) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 1-(2-phenylethyl)pyrazole-3-carboxylic acid. InChIKey: IKXZQEQXYLLBPJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 1-(2-phenylethyl)pyrazole-3-carboxylic acid |
| InChIKey | IKXZQEQXYLLBPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)