CAS 13429-12-4 appears in our catalog under these names: 4-Bromo-3,5-dihydroxybenzamide, 95%, 4-Bromo-3,5-dihydroxybenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
4-bromo-3,5-dihydroxybenzamide (CAS 13429-12-4) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 4-bromo-3,5-dihydroxybenzamide. InChIKey: GCNIEGHLVCGBRA-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 4-bromo-3,5-dihydroxybenzamide |
| InChIKey | GCNIEGHLVCGBRA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)Br)O)C(=O)N |
Computed by PubChem (NCBI)