CAS 1343056-10-9 appears in our catalog under these names: 1-(Cyclopropanesulfonyl)-1,4-diazepane, 95%, 1-(Cyclopropylsulfonyl)-1,4-diazepane, 95%, 95%, 1-(Cyclopropylsulfonyl)-1,4-diazepane, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1g, 2.5g, 5g, 10g.
1-cyclopropylsulfonyl-1,4-diazepane (CAS 1343056-10-9) is a chemical compound with the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. IUPAC name: 1-cyclopropylsulfonyl-1,4-diazepane. InChIKey: RTVOCMJYAAFMOI-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 1-cyclopropylsulfonyl-1,4-diazepane |
| InChIKey | RTVOCMJYAAFMOI-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2CC2 |
Computed by PubChem (NCBI)