Products 134319-22-5
CAS 134319-22-5 appears in our catalog under these names: 3-N-Propoxypicolinic acid n-propyl ester, 95%, Propyl 3-propoxypicolinate, 95%, Propyl 3–Propoxypyridine–2–carboxylate, Propyl 3-Propoxypyridine-2-carboxylate, >98.0%(GC), Propyl 3-propoxypicolinate, 98.0%, 98.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 5g, 1g, 200mg.
Propyl 3-propoxypyridine-2-carboxylate (CAS 134319-22-5) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: propyl 3-propoxypyridine-2-carboxylate. InChIKey: ZGUCGLNLZXLQTD-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | propyl 3-propoxypyridine-2-carboxylate |
| InChIKey | ZGUCGLNLZXLQTD-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(N=CC=C1)C(=O)OCCC |
Computed by PubChem (NCBI)