Products 13432-81-0

CAS 13432-81-0 appears in our catalog under these names: 3,5-Dichloro-4-hydroxybenzenesulfonyl chloride, 95%, 3,5-Dichloro-4-hydroxybenzenesulfonyl chloride, 3,5-Dichloro-4-hydroxybenzene-1-sulfonyl chloride 98%, 3,5-Dichloro-4-hydroxybenzenesulfonyl chloride, 90%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 2g, 100mg, 250mg, 10g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-hydroxybenzenesulfonyl chloride (CAS 13432-81-0) is a chemical compound with the molecular formula C6H3Cl3O3S and a molecular weight of 261.5 g/mol. IUPAC name: 3,5-dichloro-4-hydroxybenzenesulfonyl chloride. InChIKey: AELFLPJWVRGXKU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl3O3S
Molecular weight261.5 g/mol
IUPAC name3,5-dichloro-4-hydroxybenzenesulfonyl chloride
InChIKeyAELFLPJWVRGXKU-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)O)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)