Products 23378-88-3

CAS 23378-88-3 appears in our catalog under these names: 3,5-Dichloro-2-hydroxybenzenesulfonyl chloride, 95%, 3,5-Dichloro-2-hydroxybenzenesulfonyl chloride, 97% , 2,4-Dichlorophenol-6-sulphonyl chloride, 3,5-Dichloro-2-hydroxybenzenesulfonyl chloride 99%, 3,5-DICHLORO-2-HYDROXYBENZENESULFONYL. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g.

Structural formula: {0} (CAS {1})

3,5-dichloro-2-hydroxybenzenesulfonyl chloride (CAS 23378-88-3) is a chemical compound with the molecular formula C6H3Cl3O3S and a molecular weight of 261.5 g/mol. IUPAC name: 3,5-dichloro-2-hydroxybenzenesulfonyl chloride. InChIKey: KXFQRJNVGBIDHA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl3O3S
Molecular weight261.5 g/mol
IUPAC name3,5-dichloro-2-hydroxybenzenesulfonyl chloride
InChIKeyKXFQRJNVGBIDHA-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1S(=O)(=O)Cl)O)Cl)Cl

Computed by PubChem (NCBI)