Products 71292-90-5

CAS 71292-90-5 appears in our catalog under these names: 2,5-Dichloro-4-hydroxybenzene-1-sulfonyl chloride, 95%, 2,5-Dichloro-4-hydroxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,5-dichloro-4-hydroxybenzenesulfonyl chloride (CAS 71292-90-5) is a chemical compound with the molecular formula C6H3Cl3O3S and a molecular weight of 261.5 g/mol. IUPAC name: 2,5-dichloro-4-hydroxybenzenesulfonyl chloride. InChIKey: LHJRLFNGLLFHQN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl3O3S
Molecular weight261.5 g/mol
IUPAC name2,5-dichloro-4-hydroxybenzenesulfonyl chloride
InChIKeyLHJRLFNGLLFHQN-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Cl)S(=O)(=O)Cl)Cl)O

Computed by PubChem (NCBI)