Products 134332-50-6
CAS 134332-50-6 appears in our catalog under these names: Galanthamine N-Oxide, >95% (HPLC), Galanthamine N-Oxide/ 99.29% (existing batch purity), Galanthamine N–Oxide, Galanthamine N-oxide, Galanthamine N-Oxide, 99.90%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 50mg, 1 mg, 5 mg, 10 mg.
(1S,4R,12S,14R)-9-methoxy-4-methyl-4-oxido-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (CAS 134332-50-6) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: (1S,4R,12S,14R)-9-methoxy-4-methyl-4-oxido-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol. InChIKey: LROQBKNDGTWXET-CSBKYJRVSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (1S,4R,12S,14R)-9-methoxy-4-methyl-4-oxido-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| InChIKey | LROQBKNDGTWXET-CSBKYJRVSA-N |
| SMILES | C[N@+]1(CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)O)[O-] |
Computed by PubChem (NCBI)