Products 239073-59-7

CAS 239073-59-7 is the registry number for Trans 4-(2-methoxycarbonyl-vinyl)-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate (CAS 239073-59-7) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: benzyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate. InChIKey: CVPIHSDATFCHKU-BQYQJAHWSA-N.

Identity
Molecular formulaC17H21NO4
Molecular weight303.35 g/mol
IUPAC namebenzyl 4-[(E)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate
InChIKeyCVPIHSDATFCHKU-BQYQJAHWSA-N
SMILESCOC(=O)/C=C/C1CCN(CC1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)