Products 885266-53-5

CAS 885266-53-5 is the registry number for 3-[1-(tert-Butoxycarbonyl)indol-3-yl]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid (CAS 885266-53-5) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid. InChIKey: JPMVLMBCHRXPLT-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21NO4
Molecular weight303.35 g/mol
IUPAC name3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]butanoic acid
InChIKeyJPMVLMBCHRXPLT-UHFFFAOYSA-N
SMILESCC(CC(=O)O)C1=CN(C2=CC=CC=C21)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)