Products 1343697-77-7

CAS 1343697-77-7 is the registry number for 4-Carboxymethyl-(1,4)diazepane-1-carboxylic acid tert-butyl ester. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]acetic acid (CAS 1343697-77-7) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]acetic acid. InChIKey: RNHYMDLOHYODKD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O4
Molecular weight258.31 g/mol
IUPAC name2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepan-1-yl]acetic acid
InChIKeyRNHYMDLOHYODKD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCN(CC1)CC(=O)O

Computed by PubChem (NCBI)