CAS 1343757-05-0 is the registry number for 4-Amino-3,5-difluoro-N-(2-methylpropyl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-3,5-difluoro-N-(2-methylpropyl)benzamide (CAS 1343757-05-0) is a chemical compound with the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. IUPAC name: 4-amino-3,5-difluoro-N-(2-methylpropyl)benzamide. InChIKey: BXITUGWGZFWLCK-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-amino-3,5-difluoro-N-(2-methylpropyl)benzamide |
| InChIKey | BXITUGWGZFWLCK-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)C1=CC(=C(C(=C1)F)N)F |
Computed by PubChem (NCBI)