CAS 2091713-65-2 is the registry number for (1–(4–aminophenyl)–4,4–difluoropyrrolidin–2–yl)methanol. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
[1-(4-aminophenyl)-4,4-difluoropyrrolidin-2-yl]methanol (CAS 2091713-65-2) is a chemical compound with the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. IUPAC name: [1-(4-aminophenyl)-4,4-difluoropyrrolidin-2-yl]methanol. InChIKey: AAGZARSDXOYBBB-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | [1-(4-aminophenyl)-4,4-difluoropyrrolidin-2-yl]methanol |
| InChIKey | AAGZARSDXOYBBB-UHFFFAOYSA-N |
| SMILES | C1C(N(CC1(F)F)C2=CC=C(C=C2)N)CO |
Computed by PubChem (NCBI)