CAS 2921857-35-2 is the registry number for 4-(2,6-difluoropyridin-3-yl)-1-methylpiperidin-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2,6-difluoro-3-pyridinyl)-1-methylpiperidin-4-ol (CAS 2921857-35-2) is a chemical compound with the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. IUPAC name: 4-(2,6-difluoro-3-pyridinyl)-1-methylpiperidin-4-ol. InChIKey: HZBVEVXHIBBYGO-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-(2,6-difluoro-3-pyridinyl)-1-methylpiperidin-4-ol |
| InChIKey | HZBVEVXHIBBYGO-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)(C2=C(N=C(C=C2)F)F)O |
Computed by PubChem (NCBI)