CAS 1344006-94-5 appears in our catalog under these names: 1,1,1-Trifluoro-3-(4-fluorophenyl)propan-2-ol, 95%, 1,1,1-Trifluoro-3-(4-fluorophenyl)propan-2-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,1,1-trifluoro-3-(4-fluorophenyl)propan-2-ol (CAS 1344006-94-5) is a chemical compound with the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. IUPAC name: 1,1,1-trifluoro-3-(4-fluorophenyl)propan-2-ol. InChIKey: NNHSNLBBGIBVDH-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-(4-fluorophenyl)propan-2-ol |
| InChIKey | NNHSNLBBGIBVDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(F)(F)F)O)F |
Computed by PubChem (NCBI)