Products 1344032-05-8

CAS 1344032-05-8 is the registry number for Gabapentin Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[1-[[(3-oxo-2-azaspiro[4.5]decane-2-carbonyl)amino]methyl]cyclohexyl]acetic acid (CAS 1344032-05-8) is a chemical compound with the molecular formula C19H30N2O4 and a molecular weight of 350.5 g/mol. IUPAC name: 2-[1-[[(3-oxo-2-azaspiro[4.5]decane-2-carbonyl)amino]methyl]cyclohexyl]acetic acid. InChIKey: LQOJJAHELHZMST-UHFFFAOYSA-N.

Identity
Molecular formulaC19H30N2O4
Molecular weight350.5 g/mol
IUPAC name2-[1-[[(3-oxo-2-azaspiro[4.5]decane-2-carbonyl)amino]methyl]cyclohexyl]acetic acid
InChIKeyLQOJJAHELHZMST-UHFFFAOYSA-N
SMILESC1CCC2(CC1)CC(=O)N(C2)C(=O)NCC3(CCCCC3)CC(=O)O

Computed by PubChem (NCBI)