CAS 137828-53-6 is the registry number for Boc-Phe-(R)-Val-OH. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]amino]butanoic acid (CAS 137828-53-6) is a chemical compound with the molecular formula C19H30N2O4 and a molecular weight of 350.5 g/mol. IUPAC name: (2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]amino]butanoic acid. InChIKey: PPCJIJPKRLPTIF-HOTGVXAUSA-N.
| Molecular formula | C19H30N2O4 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]amino]butanoic acid |
| InChIKey | PPCJIJPKRLPTIF-HOTGVXAUSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC[C@H](CC1=CC=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)