Products 1374635-44-5
CAS 1374635-44-5 is the registry number for (S)-Benzyl tert-butyl (3,3-dimethylbutane-1,2-diyl)dicarbamate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Benzyl N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate (CAS 1374635-44-5) is a chemical compound with the molecular formula C19H30N2O4 and a molecular weight of 350.5 g/mol. IUPAC name: benzyl N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate. InChIKey: JPIRNXMJEMOYQD-OAHLLOKOSA-N.
| Molecular formula | C19H30N2O4 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | benzyl N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate |
| InChIKey | JPIRNXMJEMOYQD-OAHLLOKOSA-N |
| SMILES | CC(C)(C)[C@@H](CNC(=O)OC(C)(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)